C14H8O3 — CID 71358715
5-oxatricyclo[7.6.0.03,7]pentadeca-1,3(7),8,10,12,14-hexaene-4,6-dione (PubChem CID 71358715) has the molecular formula C14H8O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-oxatricyclo[7.6.0.03,7]pentadeca-1,3(7),8,10,12,14-hexaene-4,6-dione.
| Compound Name | 5-oxatricyclo[7.6.0.03,7]pentadeca-1,3(7),8,10,12,14-hexaene-4,6-dione |
|---|---|
| PubChem CID | 71358715 |
| Molecular Formula | C14H8O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 5-oxatricyclo[7.6.0.03,7]pentadeca-1,3(7),8,10,12,14-hexaene-4,6-dione |
| SMILES | O=c1oc(=O)c2cc3ccccccc3cc12 |
| InChI | InChI=1S/C14H8O3/c15-13-11-7-9-5-3-1-2-4-6-10(9)8-12(11)14(16)17-13/h1-8H/b2-1-,3-1-,4-2-,5-3-,6-4-,9-5-,10-6- |
| InChIKey | VLEVFSQSNBCSEB-CKSLBRPTSA-N |
| XLogP | 2.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |