N-diazocarbamoyl fluoride

CFN3O — CID 71358879

IUPACN-diazocarbamoyl fluoride
SMILES[N-]=[N+]=NC(=O)F
InChIInChI=1S/CFN3O/c2-1(6)4-5-3
InChIKeyNTMFECZLGUAZRI-UHFFFAOYSA-N
MW89.03 g/mol
LogP1.39
Rot. Bonds

About N-diazocarbamoyl fluoride

N-diazocarbamoyl fluoride (PubChem CID 71358879) has the molecular formula CFN3O and a molecular weight of 89.03 g/mol. Its IUPAC name is N-diazocarbamoyl fluoride.

Molecular Properties

Compound NameN-diazocarbamoyl fluoride
PubChem CID71358879
Molecular FormulaCFN3O
Molecular Weight89.03 g/mol
Exact Mass89.00
IUPAC NameN-diazocarbamoyl fluoride
SMILES[N-]=[N+]=NC(=O)F
InChIInChI=1S/CFN3O/c2-1(6)4-5-3
InChIKeyNTMFECZLGUAZRI-UHFFFAOYSA-N
XLogP1.39
TPSA65.83 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50089.03
LogP ≤ 51.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-diazocarbamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-diazocarbamoyl fluoride?
The IUPAC name of N-diazocarbamoyl fluoride (CID 71358879) is N-diazocarbamoyl fluoride.
What is the SMILES notation for N-diazocarbamoyl fluoride?
The canonical SMILES for N-diazocarbamoyl fluoride is [N-]=[N+]=NC(=O)F.
What is the InChIKey of N-diazocarbamoyl fluoride?
The InChIKey is NTMFECZLGUAZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/CFN3O/c2-1(6)4-5-3.
What are the key properties of N-diazocarbamoyl fluoride?
N-diazocarbamoyl fluoride has a molecular weight of 89.03 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-diazocarbamoyl fluoride is sourced from PubChem (CID 71358879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).