About cycloocta[c]pyridazine
cycloocta[c]pyridazine (PubChem CID 71358921) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is cycloocta[c]pyridazine.
Molecular Properties
| Compound Name | cycloocta[c]pyridazine |
| PubChem CID | 71358921 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | cycloocta[c]pyridazine |
| SMILES | C1=CC=c2ccnnc2=CC=C1 |
| InChI | InChI=1S/C10H8N2/c1-2-4-6-10-9(5-3-1)7-8-11-12-10/h1-8H |
| InChIKey | LVXISFZEKNJQEN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cycloocta[c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloocta[c]pyridazine?
The IUPAC name of cycloocta[c]pyridazine (CID 71358921) is cycloocta[c]pyridazine.
What is the SMILES notation for cycloocta[c]pyridazine?
The canonical SMILES for cycloocta[c]pyridazine is C1=CC=c2ccnnc2=CC=C1.
What is the InChIKey of cycloocta[c]pyridazine?
The InChIKey is LVXISFZEKNJQEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-4-6-10-9(5-3-1)7-8-11-12-10/h1-8H.
What are the key properties of cycloocta[c]pyridazine?
cycloocta[c]pyridazine has a molecular weight of 156.19 g/mol, XLogP of 0.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloocta[c]pyridazine is sourced from PubChem (CID 71358921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).