About 1H-cyclohepta[c]furan
1H-cyclohepta[c]furan (PubChem CID 71358935) has the molecular formula C9H8O
and a molecular weight of 132.16 g/mol. Its IUPAC name is 1H-cyclohepta[c]furan.
Molecular Properties
| Compound Name | 1H-cyclohepta[c]furan |
| PubChem CID | 71358935 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 1H-cyclohepta[c]furan |
| SMILES | C1=CC=C2COC=C2C=C1 |
| InChI | InChI=1S/C9H8O/c1-2-4-8-6-10-7-9(8)5-3-1/h1-6H,7H2 |
| InChIKey | LHEJWXFNWDHZDB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-cyclohepta[c]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cyclohepta[c]furan?
The IUPAC name of 1H-cyclohepta[c]furan (CID 71358935) is 1H-cyclohepta[c]furan.
What is the SMILES notation for 1H-cyclohepta[c]furan?
The canonical SMILES for 1H-cyclohepta[c]furan is C1=CC=C2COC=C2C=C1.
What is the InChIKey of 1H-cyclohepta[c]furan?
The InChIKey is LHEJWXFNWDHZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O/c1-2-4-8-6-10-7-9(8)5-3-1/h1-6H,7H2.
What are the key properties of 1H-cyclohepta[c]furan?
1H-cyclohepta[c]furan has a molecular weight of 132.16 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cyclohepta[c]furan is sourced from PubChem (CID 71358935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).