(1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid

C5H9NO3S — CID 71358987

IUPAC(1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid
SMILESO=C(O)[C@@H]1C[S@@](=O)CCN1
InChIInChI=1S/C5H9NO3S/c7-5(8)4-3-10(9)2-1-6-4/h4,6H,1-3H2,(H,7,8)/t4-,10-/m0/s1
InChIKeyXXMSBUDHKMHMTJ-MFXDVPHUSA-N
MW163.20 g/mol
LogP-1.21
Rot. Bonds1

About (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid

(1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 71358987) has the molecular formula C5H9NO3S and a molecular weight of 163.20 g/mol. Its IUPAC name is (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid.

Molecular Properties

Compound Name(1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid
PubChem CID71358987
Molecular FormulaC5H9NO3S
Molecular Weight163.20 g/mol
Exact Mass163.03
IUPAC Name(1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid
SMILESO=C(O)[C@@H]1C[S@@](=O)CCN1
InChIInChI=1S/C5H9NO3S/c7-5(8)4-3-10(9)2-1-6-4/h4,6H,1-3H2,(H,7,8)/t4-,10-/m0/s1
InChIKeyXXMSBUDHKMHMTJ-MFXDVPHUSA-N
XLogP-1.21
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.20
LogP ≤ 5-1.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid?
The IUPAC name of (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid (CID 71358987) is (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid.
What is the SMILES notation for (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid?
The canonical SMILES for (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid is O=C(O)[C@@H]1C[S@@](=O)CCN1.
What is the InChIKey of (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid?
The InChIKey is XXMSBUDHKMHMTJ-MFXDVPHUSA-N. The full InChI is InChI=1S/C5H9NO3S/c7-5(8)4-3-10(9)2-1-6-4/h4,6H,1-3H2,(H,7,8)/t4-,10-/m0/s1.
What are the key properties of (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid?
(1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid has a molecular weight of 163.20 g/mol, XLogP of -1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-1-oxo-1,4-thiazinane-3-carboxylic acid is sourced from PubChem (CID 71358987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).