C13H6N2O4 — CID 71359007
13-oxa-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-6,12,14-trione (PubChem CID 71359007) has the molecular formula C13H6N2O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is 13-oxa-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-6,12,14-trione.
| Compound Name | 13-oxa-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-6,12,14-trione |
|---|---|
| PubChem CID | 71359007 |
| Molecular Formula | C13H6N2O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 13-oxa-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-6,12,14-trione |
| SMILES | O=c1[nH]c2ccc3c(=O)oc(=O)c4ccc([nH]1)c2c34 |
| InChI | InChI=1S/C13H6N2O4/c16-11-5-1-3-7-10-8(15-13(18)14-7)4-2-6(9(5)10)12(17)19-11/h1-4H,(H2,14,15,18) |
| InChIKey | ZIQKNRURSDRQQR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|