About 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one
3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (PubChem CID 71359684) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| PubChem CID | 71359684 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| SMILES | O=C1CCCC2=C1C(O)CO2 |
| InChI | InChI=1S/C8H10O3/c9-5-2-1-3-7-8(5)6(10)4-11-7/h6,10H,1-4H2 |
| InChIKey | JLVKXUCHTRUYJT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The IUPAC name of 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (CID 71359684) is 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
What is the SMILES notation for 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The canonical SMILES for 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one is O=C1CCCC2=C1C(O)CO2.
What is the InChIKey of 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The InChIKey is JLVKXUCHTRUYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c9-5-2-1-3-7-8(5)6(10)4-11-7/h6,10H,1-4H2.
What are the key properties of 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one has a molecular weight of 154.16 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one is sourced from PubChem (CID 71359684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).