C9H16N2O2 — CID 71359704
(3S,6S)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione (PubChem CID 71359704) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (3S,6S)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 71359704 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (3S,6S)-3-[(2S)-butan-2-yl]-6-methylpiperazine-2,5-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C9H16N2O2/c1-4-5(2)7-9(13)10-6(3)8(12)11-7/h5-7H,4H2,1-3H3,(H,10,13)(H,11,12)/t5-,6-,7-/m0/s1 |
| InChIKey | JDRIJDPCYNFZIT-ACZMJKKPSA-N |
| XLogP | 0.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |