About cyclohexene-1,3,5-tricarbonitrile
cyclohexene-1,3,5-tricarbonitrile (PubChem CID 71360143) has the molecular formula C9H7N3
and a molecular weight of 157.18 g/mol. Its IUPAC name is cyclohexene-1,3,5-tricarbonitrile.
Molecular Properties
| Compound Name | cyclohexene-1,3,5-tricarbonitrile |
| PubChem CID | 71360143 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | cyclohexene-1,3,5-tricarbonitrile |
| SMILES | N#CC1=CC(C#N)CC(C#N)C1 |
| InChI | InChI=1S/C9H7N3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1,7,9H,2-3H2 |
| InChIKey | FNSAUXDOGYDCIX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexene-1,3,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene-1,3,5-tricarbonitrile?
The IUPAC name of cyclohexene-1,3,5-tricarbonitrile (CID 71360143) is cyclohexene-1,3,5-tricarbonitrile.
What is the SMILES notation for cyclohexene-1,3,5-tricarbonitrile?
The canonical SMILES for cyclohexene-1,3,5-tricarbonitrile is N#CC1=CC(C#N)CC(C#N)C1.
What is the InChIKey of cyclohexene-1,3,5-tricarbonitrile?
The InChIKey is FNSAUXDOGYDCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1,7,9H,2-3H2.
What are the key properties of cyclohexene-1,3,5-tricarbonitrile?
cyclohexene-1,3,5-tricarbonitrile has a molecular weight of 157.18 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene-1,3,5-tricarbonitrile is sourced from PubChem (CID 71360143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).