C15H26O2 — CID 71360372
3,7,11-trimethyldodeca-1,6,10-triene-3,9-diol (PubChem CID 71360372) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-1,6,10-triene-3,9-diol.
| Compound Name | 3,7,11-trimethyldodeca-1,6,10-triene-3,9-diol |
|---|---|
| PubChem CID | 71360372 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 3,7,11-trimethyldodeca-1,6,10-triene-3,9-diol |
| SMILES | C=CC(C)(O)CCC=C(C)CC(O)C=C(C)C |
| InChI | InChI=1S/C15H26O2/c1-6-15(5,17)9-7-8-13(4)11-14(16)10-12(2)3/h6,8,10,14,16-17H,1,7,9,11H2,2-5H3 |
| InChIKey | TZCKNDPYYKEPHO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|