C14H26O3 — CID 71360636
3-[5-(1-ethoxyethoxy)-3-methylpent-3-enyl]-2,2-dimethyloxirane (PubChem CID 71360636) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-[5-(1-ethoxyethoxy)-3-methylpent-3-enyl]-2,2-dimethyloxirane.
| Compound Name | 3-[5-(1-ethoxyethoxy)-3-methylpent-3-enyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 71360636 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 3-[5-(1-ethoxyethoxy)-3-methylpent-3-enyl]-2,2-dimethyloxirane |
| SMILES | CCOC(C)OCC=C(C)CCC1OC1(C)C |
| InChI | InChI=1S/C14H26O3/c1-6-15-12(3)16-10-9-11(2)7-8-13-14(4,5)17-13/h9,12-13H,6-8,10H2,1-5H3 |
| InChIKey | UWQATDONXCINAS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|