About methyl 5-phenylpent-1-en-3-yl carbonate
methyl 5-phenylpent-1-en-3-yl carbonate (PubChem CID 71360684) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 5-phenylpent-1-en-3-yl carbonate.
Molecular Properties
| Compound Name | methyl 5-phenylpent-1-en-3-yl carbonate |
| PubChem CID | 71360684 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | methyl 5-phenylpent-1-en-3-yl carbonate |
| SMILES | C=CC(CCc1ccccc1)OC(=O)OC |
| InChI | InChI=1S/C13H16O3/c1-3-12(16-13(14)15-2)10-9-11-7-5-4-6-8-11/h3-8,12H,1,9-10H2,2H3 |
| InChIKey | AUOSKDROUSTSHI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-phenylpent-1-en-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-phenylpent-1-en-3-yl carbonate?
The IUPAC name of methyl 5-phenylpent-1-en-3-yl carbonate (CID 71360684) is methyl 5-phenylpent-1-en-3-yl carbonate.
What is the SMILES notation for methyl 5-phenylpent-1-en-3-yl carbonate?
The canonical SMILES for methyl 5-phenylpent-1-en-3-yl carbonate is C=CC(CCc1ccccc1)OC(=O)OC.
What is the InChIKey of methyl 5-phenylpent-1-en-3-yl carbonate?
The InChIKey is AUOSKDROUSTSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-3-12(16-13(14)15-2)10-9-11-7-5-4-6-8-11/h3-8,12H,1,9-10H2,2H3.
What are the key properties of methyl 5-phenylpent-1-en-3-yl carbonate?
methyl 5-phenylpent-1-en-3-yl carbonate has a molecular weight of 220.27 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-phenylpent-1-en-3-yl carbonate is sourced from PubChem (CID 71360684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).