About N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine
N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine (PubChem CID 71360719) has the molecular formula C3H8N6O3
and a molecular weight of 176.14 g/mol. Its IUPAC name is N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine |
| PubChem CID | 71360719 |
| Molecular Formula | C3H8N6O3 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine |
| SMILES | O=NN1CN(N=O)CN(NO)C1 |
| InChI | InChI=1S/C3H8N6O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h4,10H,1-3H2 |
| InChIKey | NVAUQRNIEAUBFA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine?
The IUPAC name of N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine (CID 71360719) is N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine.
What is the SMILES notation for N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine?
The canonical SMILES for N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine is O=NN1CN(N=O)CN(NO)C1.
What is the InChIKey of N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine?
The InChIKey is NVAUQRNIEAUBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N6O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h4,10H,1-3H2.
What are the key properties of N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine?
N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine has a molecular weight of 176.14 g/mol, XLogP of -0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dinitroso-1,3,5-triazinan-1-yl)hydroxylamine is sourced from PubChem (CID 71360719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).