About 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane
2-ethenyl-3-non-1-en-3,5,7-triynyloxirane (PubChem CID 71360874) has the molecular formula C13H10O
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane.
Molecular Properties
| Compound Name | 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane |
| PubChem CID | 71360874 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane |
| SMILES | C=CC1OC1C=CC#CC#CC#CC |
| InChI | InChI=1S/C13H10O/c1-3-5-6-7-8-9-10-11-13-12(4-2)14-13/h4,10-13H,2H2,1H3 |
| InChIKey | ZJMXHGIVVFPAJY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane?
The IUPAC name of 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane (CID 71360874) is 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane.
What is the SMILES notation for 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane?
The canonical SMILES for 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane is C=CC1OC1C=CC#CC#CC#CC.
What is the InChIKey of 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane?
The InChIKey is ZJMXHGIVVFPAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O/c1-3-5-6-7-8-9-10-11-13-12(4-2)14-13/h4,10-13H,2H2,1H3.
What are the key properties of 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane?
2-ethenyl-3-non-1-en-3,5,7-triynyloxirane has a molecular weight of 182.22 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3-non-1-en-3,5,7-triynyloxirane is sourced from PubChem (CID 71360874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).