About 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol
2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol (PubChem CID 71360876) has the molecular formula C11H9Cl2F3O
and a molecular weight of 285.09 g/mol. Its IUPAC name is 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol.
Molecular Properties
| Compound Name | 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol |
| PubChem CID | 71360876 |
| Molecular Formula | C11H9Cl2F3O |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol |
| SMILES | OC(C=Cc1ccccc1)(C(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C11H9Cl2F3O/c12-9(13)10(17,11(14,15)16)7-6-8-4-2-1-3-5-8/h1-7,9,17H |
| InChIKey | ZQXQALLCELNLFG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
The IUPAC name of 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol (CID 71360876) is 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol.
What is the SMILES notation for 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
The canonical SMILES for 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol is OC(C=Cc1ccccc1)(C(Cl)Cl)C(F)(F)F.
What is the InChIKey of 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
The InChIKey is ZQXQALLCELNLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2F3O/c12-9(13)10(17,11(14,15)16)7-6-8-4-2-1-3-5-8/h1-7,9,17H.
What are the key properties of 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol has a molecular weight of 285.09 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol is sourced from PubChem (CID 71360876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).