About undeca-1,5,8-trien-3-ol
undeca-1,5,8-trien-3-ol (PubChem CID 71360907) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is undeca-1,5,8-trien-3-ol.
Molecular Properties
| Compound Name | undeca-1,5,8-trien-3-ol |
| PubChem CID | 71360907 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | undeca-1,5,8-trien-3-ol |
| SMILES | C=CC(O)CC=CCC=CCC |
| InChI | InChI=1S/C11H18O/c1-3-5-6-7-8-9-10-11(12)4-2/h4-6,8-9,11-12H,2-3,7,10H2,1H3 |
| InChIKey | PRGYPCCRPKULHH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undeca-1,5,8-trien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undeca-1,5,8-trien-3-ol?
The IUPAC name of undeca-1,5,8-trien-3-ol (CID 71360907) is undeca-1,5,8-trien-3-ol.
What is the SMILES notation for undeca-1,5,8-trien-3-ol?
The canonical SMILES for undeca-1,5,8-trien-3-ol is C=CC(O)CC=CCC=CCC.
What is the InChIKey of undeca-1,5,8-trien-3-ol?
The InChIKey is PRGYPCCRPKULHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-3-5-6-7-8-9-10-11(12)4-2/h4-6,8-9,11-12H,2-3,7,10H2,1H3.
What are the key properties of undeca-1,5,8-trien-3-ol?
undeca-1,5,8-trien-3-ol has a molecular weight of 166.26 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undeca-1,5,8-trien-3-ol is sourced from PubChem (CID 71360907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).