About 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide
1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide (PubChem CID 71361025) has the molecular formula C9H19BrN2
and a molecular weight of 235.17 g/mol. Its IUPAC name is 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide.
Molecular Properties
| Compound Name | 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide |
| PubChem CID | 71361025 |
| Molecular Formula | C9H19BrN2 |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide |
| SMILES | CCCCCN1C=C[NH+](C)C1.[Br-] |
| InChI | InChI=1S/C9H18N2.BrH/c1-3-4-5-6-11-8-7-10(2)9-11;/h7-8H,3-6,9H2,1-2H3;1H |
| InChIKey | IYBQNYKGZGGEKT-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide?
The IUPAC name of 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide (CID 71361025) is 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide.
What is the SMILES notation for 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide?
The canonical SMILES for 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide is CCCCCN1C=C[NH+](C)C1.[Br-].
What is the InChIKey of 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide?
The InChIKey is IYBQNYKGZGGEKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.BrH/c1-3-4-5-6-11-8-7-10(2)9-11;/h7-8H,3-6,9H2,1-2H3;1H.
What are the key properties of 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide?
1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide has a molecular weight of 235.17 g/mol, XLogP of -2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-pentyl-1,2-dihydroimidazol-1-ium bromide is sourced from PubChem (CID 71361025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).