About 1-phenylpentazole
1-phenylpentazole (PubChem CID 71361153) has the molecular formula C6H5N5
and a molecular weight of 147.14 g/mol. Its IUPAC name is 1-phenylpentazole.
Molecular Properties
| Compound Name | 1-phenylpentazole |
| PubChem CID | 71361153 |
| Molecular Formula | C6H5N5 |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 1-phenylpentazole |
| SMILES | c1ccc(-n2nnnn2)cc1 |
| InChI | InChI=1S/C6H5N5/c1-2-4-6(5-3-1)11-9-7-8-10-11/h1-5H |
| InChIKey | KMRDNOKWDDOCNT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-phenylpentazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpentazole?
The IUPAC name of 1-phenylpentazole (CID 71361153) is 1-phenylpentazole.
What is the SMILES notation for 1-phenylpentazole?
The canonical SMILES for 1-phenylpentazole is c1ccc(-n2nnnn2)cc1.
What is the InChIKey of 1-phenylpentazole?
The InChIKey is KMRDNOKWDDOCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5/c1-2-4-6(5-3-1)11-9-7-8-10-11/h1-5H.
What are the key properties of 1-phenylpentazole?
1-phenylpentazole has a molecular weight of 147.14 g/mol, XLogP of 0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpentazole is sourced from PubChem (CID 71361153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).