About 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol
6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol (PubChem CID 71361300) has the molecular formula C16H22O4
and a molecular weight of 278.35 g/mol. Its IUPAC name is 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol.
Molecular Properties
| Compound Name | 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol |
| PubChem CID | 71361300 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol |
| SMILES | CC1(CCCC2CCCC(O)O2)Oc2ccccc2O1 |
| InChI | InChI=1S/C16H22O4/c1-16(19-13-8-2-3-9-14(13)20-16)11-5-7-12-6-4-10-15(17)18-12/h2-3,8-9,12,15,17H,4-7,10-11H2,1H3 |
| InChIKey | FTURWHDOBOEUIB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol?
The IUPAC name of 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol (CID 71361300) is 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol.
What is the SMILES notation for 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol?
The canonical SMILES for 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol is CC1(CCCC2CCCC(O)O2)Oc2ccccc2O1.
What is the InChIKey of 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol?
The InChIKey is FTURWHDOBOEUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-16(19-13-8-2-3-9-14(13)20-16)11-5-7-12-6-4-10-15(17)18-12/h2-3,8-9,12,15,17H,4-7,10-11H2,1H3.
What are the key properties of 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol?
6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol has a molecular weight of 278.35 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(2-methyl-1,3-benzodioxol-2-yl)propyl]oxan-2-ol is sourced from PubChem (CID 71361300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).