N-sulfamoylsulfamoyl chloride

H3ClN2O4S2 — CID 71361460

IUPACN-sulfamoylsulfamoyl chloride
SMILESNS(=O)(=O)NS(=O)(=O)Cl
InChIInChI=1S/ClH3N2O4S2/c1-8(4,5)3-9(2,6)7/h3H,(H2,2,6,7)
InChIKeyITULBIVBYPMSCU-UHFFFAOYSA-N
MW194.62 g/mol
LogP-1.74
Rot. Bonds2

About N-sulfamoylsulfamoyl chloride

N-sulfamoylsulfamoyl chloride (PubChem CID 71361460) has the molecular formula H3ClN2O4S2 and a molecular weight of 194.62 g/mol. Its IUPAC name is N-sulfamoylsulfamoyl chloride.

Molecular Properties

Compound NameN-sulfamoylsulfamoyl chloride
PubChem CID71361460
Molecular FormulaH3ClN2O4S2
Molecular Weight194.62 g/mol
Exact Mass193.92
IUPAC NameN-sulfamoylsulfamoyl chloride
SMILESNS(=O)(=O)NS(=O)(=O)Cl
InChIInChI=1S/ClH3N2O4S2/c1-8(4,5)3-9(2,6)7/h3H,(H2,2,6,7)
InChIKeyITULBIVBYPMSCU-UHFFFAOYSA-N
XLogP-1.74
TPSA106.33 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.62
LogP ≤ 5-1.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze N-sulfamoylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-sulfamoylsulfamoyl chloride?
The IUPAC name of N-sulfamoylsulfamoyl chloride (CID 71361460) is N-sulfamoylsulfamoyl chloride.
What is the SMILES notation for N-sulfamoylsulfamoyl chloride?
The canonical SMILES for N-sulfamoylsulfamoyl chloride is NS(=O)(=O)NS(=O)(=O)Cl.
What is the InChIKey of N-sulfamoylsulfamoyl chloride?
The InChIKey is ITULBIVBYPMSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/ClH3N2O4S2/c1-8(4,5)3-9(2,6)7/h3H,(H2,2,6,7).
What are the key properties of N-sulfamoylsulfamoyl chloride?
N-sulfamoylsulfamoyl chloride has a molecular weight of 194.62 g/mol, XLogP of -1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-sulfamoylsulfamoyl chloride is sourced from PubChem (CID 71361460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).