C21H21N3S — CID 7136150
(1S)-N-(3-methylphenyl)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 7136150) has the molecular formula C21H21N3S and a molecular weight of 347.49 g/mol. Its IUPAC name is (1S)-N-(3-methylphenyl)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | (1S)-N-(3-methylphenyl)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 7136150 |
| Molecular Formula | C21H21N3S |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (1S)-N-(3-methylphenyl)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CCn3cccc3[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C21H21N3S/c1-16-7-5-10-18(15-16)22-21(25)24-14-13-23-12-6-11-19(23)20(24)17-8-3-2-4-9-17/h2-12,15,20H,13-14H2,1H3,(H,22,25)/t20-/m0/s1 |
| InChIKey | QCRPIMDMLDRZIE-FQEVSTJZSA-N |
| XLogP | 4.60 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|