C12H18N4S6 — CID 71361512
5-[8-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]octylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 71361512) has the molecular formula C12H18N4S6 and a molecular weight of 410.71 g/mol. Its IUPAC name is 5-[8-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]octylsulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[8-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]octylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 71361512 |
| Molecular Formula | C12H18N4S6 |
| Molecular Weight | 410.71 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 5-[8-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]octylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(SCCCCCCCCSc2n[nH]c(=S)s2)s1 |
| InChI | InChI=1S/C12H18N4S6/c17-9-13-15-11(21-9)19-7-5-3-1-2-4-6-8-20-12-16-14-10(18)22-12/h1-8H2,(H,13,17)(H,14,18) |
| InChIKey | OCCSFOJYPLMJQJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|