C15H16ClN3S — CID 7136167
(1S)-1-(4-chlorophenyl)-N-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 7136167) has the molecular formula C15H16ClN3S and a molecular weight of 305.83 g/mol. Its IUPAC name is (1S)-1-(4-chlorophenyl)-N-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | (1S)-1-(4-chlorophenyl)-N-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 7136167 |
| Molecular Formula | C15H16ClN3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (1S)-1-(4-chlorophenyl)-N-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | CNC(=S)N1CCn2cccc2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3S/c1-17-15(20)19-10-9-18-8-2-3-13(18)14(19)11-4-6-12(16)7-5-11/h2-8,14H,9-10H2,1H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | LQMISQCNXSZKOK-AWEZNQCLSA-N |
| XLogP | 3.05 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|