About 2-acetamido-N,N-dimethylprop-2-enamide
2-acetamido-N,N-dimethylprop-2-enamide (PubChem CID 71361752) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-acetamido-N,N-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | 2-acetamido-N,N-dimethylprop-2-enamide |
| PubChem CID | 71361752 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-acetamido-N,N-dimethylprop-2-enamide |
| SMILES | C=C(NC(C)=O)C(=O)N(C)C |
| InChI | InChI=1S/C7H12N2O2/c1-5(8-6(2)10)7(11)9(3)4/h1H2,2-4H3,(H,8,10) |
| InChIKey | PHLJNLKPHLLKPW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamido-N,N-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-N,N-dimethylprop-2-enamide?
The IUPAC name of 2-acetamido-N,N-dimethylprop-2-enamide (CID 71361752) is 2-acetamido-N,N-dimethylprop-2-enamide.
What is the SMILES notation for 2-acetamido-N,N-dimethylprop-2-enamide?
The canonical SMILES for 2-acetamido-N,N-dimethylprop-2-enamide is C=C(NC(C)=O)C(=O)N(C)C.
What is the InChIKey of 2-acetamido-N,N-dimethylprop-2-enamide?
The InChIKey is PHLJNLKPHLLKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-5(8-6(2)10)7(11)9(3)4/h1H2,2-4H3,(H,8,10).
What are the key properties of 2-acetamido-N,N-dimethylprop-2-enamide?
2-acetamido-N,N-dimethylprop-2-enamide has a molecular weight of 156.18 g/mol, XLogP of -0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-N,N-dimethylprop-2-enamide is sourced from PubChem (CID 71361752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).