About 2,3-diethynylaniline
2,3-diethynylaniline (PubChem CID 71361995) has the molecular formula C10H7N
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2,3-diethynylaniline.
Molecular Properties
| Compound Name | 2,3-diethynylaniline |
| PubChem CID | 71361995 |
| Molecular Formula | C10H7N |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2,3-diethynylaniline |
| SMILES | C#Cc1cccc(N)c1C#C |
| InChI | InChI=1S/C10H7N/c1-3-8-6-5-7-10(11)9(8)4-2/h1-2,5-7H,11H2 |
| InChIKey | MVESKVHSJPZJQH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diethynylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethynylaniline?
The IUPAC name of 2,3-diethynylaniline (CID 71361995) is 2,3-diethynylaniline.
What is the SMILES notation for 2,3-diethynylaniline?
The canonical SMILES for 2,3-diethynylaniline is C#Cc1cccc(N)c1C#C.
What is the InChIKey of 2,3-diethynylaniline?
The InChIKey is MVESKVHSJPZJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N/c1-3-8-6-5-7-10(11)9(8)4-2/h1-2,5-7H,11H2.
What are the key properties of 2,3-diethynylaniline?
2,3-diethynylaniline has a molecular weight of 141.17 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethynylaniline is sourced from PubChem (CID 71361995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).