About (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane
(2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane (PubChem CID 71362605) has the molecular formula C19H36I2Si
and a molecular weight of 546.39 g/mol. Its IUPAC name is (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane.
Molecular Properties
| Compound Name | (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane |
| PubChem CID | 71362605 |
| Molecular Formula | C19H36I2Si |
| Molecular Weight | 546.39 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane |
| SMILES | CCCCCCC(I)=CC(CCCCCC)=C(I)[Si](C)(C)C |
| InChI | InChI=1S/C19H36I2Si/c1-6-8-10-12-14-17(19(21)22(3,4)5)16-18(20)15-13-11-9-7-2/h16H,6-15H2,1-5H3 |
| InChIKey | VPAAXKGDIDGZPW-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.39 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane?
The IUPAC name of (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane (CID 71362605) is (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane.
What is the SMILES notation for (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane?
The canonical SMILES for (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane is CCCCCCC(I)=CC(CCCCCC)=C(I)[Si](C)(C)C.
What is the InChIKey of (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane?
The InChIKey is VPAAXKGDIDGZPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36I2Si/c1-6-8-10-12-14-17(19(21)22(3,4)5)16-18(20)15-13-11-9-7-2/h16H,6-15H2,1-5H3.
What are the key properties of (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane?
(2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane has a molecular weight of 546.39 g/mol, XLogP of 8.81, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hexyl-1,4-diiododeca-1,3-dienyl)-trimethylsilane is sourced from PubChem (CID 71362605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).