About 4-but-3-en-1-ynylphenol
4-but-3-en-1-ynylphenol (PubChem CID 71362981) has the molecular formula C10H8O
and a molecular weight of 144.17 g/mol. Its IUPAC name is 4-but-3-en-1-ynylphenol.
Molecular Properties
| Compound Name | 4-but-3-en-1-ynylphenol |
| PubChem CID | 71362981 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 4-but-3-en-1-ynylphenol |
| SMILES | C=CC#Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H8O/c1-2-3-4-9-5-7-10(11)8-6-9/h2,5-8,11H,1H2 |
| InChIKey | ZHFFALGLSCREJF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-en-1-ynylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-en-1-ynylphenol?
The IUPAC name of 4-but-3-en-1-ynylphenol (CID 71362981) is 4-but-3-en-1-ynylphenol.
What is the SMILES notation for 4-but-3-en-1-ynylphenol?
The canonical SMILES for 4-but-3-en-1-ynylphenol is C=CC#Cc1ccc(O)cc1.
What is the InChIKey of 4-but-3-en-1-ynylphenol?
The InChIKey is ZHFFALGLSCREJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O/c1-2-3-4-9-5-7-10(11)8-6-9/h2,5-8,11H,1H2.
What are the key properties of 4-but-3-en-1-ynylphenol?
4-but-3-en-1-ynylphenol has a molecular weight of 144.17 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-en-1-ynylphenol is sourced from PubChem (CID 71362981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).