C17H17NO2 — CID 71363111
(3R,4R)-4-methyl-2,3-diphenyl-1,2-oxazolidine-4-carbaldehyde (PubChem CID 71363111) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (3R,4R)-4-methyl-2,3-diphenyl-1,2-oxazolidine-4-carbaldehyde.
| Compound Name | (3R,4R)-4-methyl-2,3-diphenyl-1,2-oxazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 71363111 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3R,4R)-4-methyl-2,3-diphenyl-1,2-oxazolidine-4-carbaldehyde |
| SMILES | C[C@]1(C=O)CON(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-17(12-19)13-20-18(15-10-6-3-7-11-15)16(17)14-8-4-2-5-9-14/h2-12,16H,13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | HKUWXKNBFWXRTH-SJORKVTESA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|