C16H21N3S2 — CID 7136321
(1R)-N-tert-butyl-1-thiophen-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 7136321) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is (1R)-N-tert-butyl-1-thiophen-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | (1R)-N-tert-butyl-1-thiophen-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 7136321 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (1R)-N-tert-butyl-1-thiophen-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | CC(C)(C)NC(=S)N1CCn2cccc2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C16H21N3S2/c1-16(2,3)17-15(20)19-10-9-18-8-4-6-12(18)14(19)13-7-5-11-21-13/h4-8,11,14H,9-10H2,1-3H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | YPDQHDLMIWAVON-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|