C14H14 — CID 71363415
octacyclo[6.6.0.02,7.03,6.04,12.05,11.09,14.010,13]tetradecane (PubChem CID 71363415) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is octacyclo[6.6.0.02,7.03,6.04,12.05,11.09,14.010,13]tetradecane.
| Compound Name | octacyclo[6.6.0.02,7.03,6.04,12.05,11.09,14.010,13]tetradecane |
|---|---|
| PubChem CID | 71363415 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | octacyclo[6.6.0.02,7.03,6.04,12.05,11.09,14.010,13]tetradecane |
| SMILES | C12C3C4C1C1C2C2C1C1C5C4C3C5C21 |
| InChI | InChI=1S/C14H14/c1-2-5-3(1)7-9(5)13-11(7)12-8-4(1)6(2)10(8)14(12)13/h1-14H |
| InChIKey | ZVTIJXOAIFQAAF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|