C11H6ClF7N4 — CID 71363505
3-(4-chlorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 71363505) has the molecular formula C11H6ClF7N4 and a molecular weight of 362.64 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3-(4-chlorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 71363505 |
| Molecular Formula | C11H6ClF7N4 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 3-(4-chlorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1=NNC(c2ccc(Cl)cc2)=NN1 |
| InChI | InChI=1S/C11H6ClF7N4/c12-6-3-1-5(2-4-6)7-20-22-8(23-21-7)9(13,14)10(15,16)11(17,18)19/h1-4H,(H,20,21)(H,22,23) |
| InChIKey | DKZZZZVGGZSJBB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|