C10H6ClF5N4 — CID 71363506
3-(4-chlorophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 71363506) has the molecular formula C10H6ClF5N4 and a molecular weight of 312.63 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3-(4-chlorophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 71363506 |
| Molecular Formula | C10H6ClF5N4 |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-(4-chlorophenyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | FC(F)(F)C(F)(F)C1=NNC(c2ccc(Cl)cc2)=NN1 |
| InChI | InChI=1S/C10H6ClF5N4/c11-6-3-1-5(2-4-6)7-17-19-8(20-18-7)9(12,13)10(14,15)16/h1-4H,(H,17,18)(H,19,20) |
| InChIKey | HXOWMBVLJZZPBC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|