About (4-chlorophenyl) phenyl phosphate
(4-chlorophenyl) phenyl phosphate (PubChem CID 71363636) has the molecular formula C12H9ClO4P-
and a molecular weight of 283.63 g/mol. Its IUPAC name is (4-chlorophenyl) phenyl phosphate.
Molecular Properties
| Compound Name | (4-chlorophenyl) phenyl phosphate |
| PubChem CID | 71363636 |
| Molecular Formula | C12H9ClO4P- |
| Molecular Weight | 283.63 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | (4-chlorophenyl) phenyl phosphate |
| SMILES | O=P([O-])(Oc1ccccc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClO4P/c13-10-6-8-12(9-7-10)17-18(14,15)16-11-4-2-1-3-5-11/h1-9H,(H,14,15)/p-1 |
| InChIKey | KLIQVCLTGXUPHY-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) phenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) phenyl phosphate?
The IUPAC name of (4-chlorophenyl) phenyl phosphate (CID 71363636) is (4-chlorophenyl) phenyl phosphate.
What is the SMILES notation for (4-chlorophenyl) phenyl phosphate?
The canonical SMILES for (4-chlorophenyl) phenyl phosphate is O=P([O-])(Oc1ccccc1)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) phenyl phosphate?
The InChIKey is KLIQVCLTGXUPHY-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10ClO4P/c13-10-6-8-12(9-7-10)17-18(14,15)16-11-4-2-1-3-5-11/h1-9H,(H,14,15)/p-1.
What are the key properties of (4-chlorophenyl) phenyl phosphate?
(4-chlorophenyl) phenyl phosphate has a molecular weight of 283.63 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) phenyl phosphate is sourced from PubChem (CID 71363636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).