About 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one
2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one (PubChem CID 71364376) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 71364376 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CN1CCn2cc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C8H9N3O3/c1-9-2-3-10-5-6(11(13)14)4-7(10)8(9)12/h4-5H,2-3H2,1H3 |
| InChIKey | YNJVODXXVWEOEW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one (CID 71364376) is 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one is CN1CCn2cc([N+](=O)[O-])cc2C1=O.
What is the InChIKey of 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is YNJVODXXVWEOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c1-9-2-3-10-5-6(11(13)14)4-7(10)8(9)12/h4-5H,2-3H2,1H3.
What are the key properties of 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 195.18 g/mol, XLogP of 0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-nitro-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 71364376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).