C15H26 — CID 71365257
7a-methyl-4-methylidene-3-(2-methylpropyl)-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 71365257) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 7a-methyl-4-methylidene-3-(2-methylpropyl)-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | 7a-methyl-4-methylidene-3-(2-methylpropyl)-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 71365257 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 7a-methyl-4-methylidene-3-(2-methylpropyl)-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CCCC2(C)CCC(CC(C)C)C12 |
| InChI | InChI=1S/C15H26/c1-11(2)10-13-7-9-15(4)8-5-6-12(3)14(13)15/h11,13-14H,3,5-10H2,1-2,4H3 |
| InChIKey | SYFFKVHWENHIGA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|