About 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan
2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan (PubChem CID 71365375) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan.
Molecular Properties
| Compound Name | 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan |
| PubChem CID | 71365375 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan |
| SMILES | Cc1ccc([C@@]2(C)CC[C@@H](C(C)C)O2)o1 |
| InChI | InChI=1S/C13H20O2/c1-9(2)11-7-8-13(4,15-11)12-6-5-10(3)14-12/h5-6,9,11H,7-8H2,1-4H3/t11-,13+/m0/s1 |
| InChIKey | OTCYDBRXABTHJM-WCQYABFASA-N |
| XLogP | 3.64 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan?
The IUPAC name of 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan (CID 71365375) is 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan.
What is the SMILES notation for 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan?
The canonical SMILES for 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan is Cc1ccc([C@@]2(C)CC[C@@H](C(C)C)O2)o1.
What is the InChIKey of 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan?
The InChIKey is OTCYDBRXABTHJM-WCQYABFASA-N. The full InChI is InChI=1S/C13H20O2/c1-9(2)11-7-8-13(4,15-11)12-6-5-10(3)14-12/h5-6,9,11H,7-8H2,1-4H3/t11-,13+/m0/s1.
What are the key properties of 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan?
2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan has a molecular weight of 208.30 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(2R,5S)-2-methyl-5-propan-2-yloxolan-2-yl]furan is sourced from PubChem (CID 71365375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).