C16H14Cl2O2 — CID 71365494
(2S,3R)-2,3-bis(4-chlorophenyl)-1,4-dioxane (PubChem CID 71365494) has the molecular formula C16H14Cl2O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is (2S,3R)-2,3-bis(4-chlorophenyl)-1,4-dioxane.
| Compound Name | (2S,3R)-2,3-bis(4-chlorophenyl)-1,4-dioxane |
|---|---|
| PubChem CID | 71365494 |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (2S,3R)-2,3-bis(4-chlorophenyl)-1,4-dioxane |
| SMILES | Clc1ccc([C@H]2OCCO[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H14Cl2O2/c17-13-5-1-11(2-6-13)15-16(20-10-9-19-15)12-3-7-14(18)8-4-12/h1-8,15-16H,9-10H2/t15-,16+ |
| InChIKey | ROPBIZIYEZEHIP-IYBDPMFKSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |