C15H17N2O2P — CID 71365624
2-oxo-N,3-diphenyl-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 71365624) has the molecular formula C15H17N2O2P and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-oxo-N,3-diphenyl-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | 2-oxo-N,3-diphenyl-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 71365624 |
| Molecular Formula | C15H17N2O2P |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-oxo-N,3-diphenyl-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | O=P1(Nc2ccccc2)OCCCN1c1ccccc1 |
| InChI | InChI=1S/C15H17N2O2P/c18-20(16-14-8-3-1-4-9-14)17(12-7-13-19-20)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2,(H,16,18) |
| InChIKey | NTMRBEUHBXPGBU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|