About 1-methyl-4-phenyl-1,4-azaphosphinane
1-methyl-4-phenyl-1,4-azaphosphinane (PubChem CID 71365636) has the molecular formula C11H16NP
and a molecular weight of 193.23 g/mol. Its IUPAC name is 1-methyl-4-phenyl-1,4-azaphosphinane.
Molecular Properties
| Compound Name | 1-methyl-4-phenyl-1,4-azaphosphinane |
| PubChem CID | 71365636 |
| Molecular Formula | C11H16NP |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 1-methyl-4-phenyl-1,4-azaphosphinane |
| SMILES | CN1CCP(c2ccccc2)CC1 |
| InChI | InChI=1S/C11H16NP/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | XRAGCZYNIIWTSW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-phenyl-1,4-azaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-phenyl-1,4-azaphosphinane?
The IUPAC name of 1-methyl-4-phenyl-1,4-azaphosphinane (CID 71365636) is 1-methyl-4-phenyl-1,4-azaphosphinane.
What is the SMILES notation for 1-methyl-4-phenyl-1,4-azaphosphinane?
The canonical SMILES for 1-methyl-4-phenyl-1,4-azaphosphinane is CN1CCP(c2ccccc2)CC1.
What is the InChIKey of 1-methyl-4-phenyl-1,4-azaphosphinane?
The InChIKey is XRAGCZYNIIWTSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16NP/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3.
What are the key properties of 1-methyl-4-phenyl-1,4-azaphosphinane?
1-methyl-4-phenyl-1,4-azaphosphinane has a molecular weight of 193.23 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-phenyl-1,4-azaphosphinane is sourced from PubChem (CID 71365636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).