About tris(pent-4-enyl)alumane
tris(pent-4-enyl)alumane (PubChem CID 71365836) has the molecular formula C15H27Al
and a molecular weight of 234.36 g/mol. Its IUPAC name is tris(pent-4-enyl)alumane.
Molecular Properties
| Compound Name | tris(pent-4-enyl)alumane |
| PubChem CID | 71365836 |
| Molecular Formula | C15H27Al |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | tris(pent-4-enyl)alumane |
| SMILES | C=CCCC[Al](CCCC=C)CCCC=C |
| InChI | InChI=1S/3C5H9.Al/c3*1-3-5-4-2;/h3*3H,1-2,4-5H2; |
| InChIKey | TZXFZYJPQYLXDS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tris(pent-4-enyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(pent-4-enyl)alumane?
The IUPAC name of tris(pent-4-enyl)alumane (CID 71365836) is tris(pent-4-enyl)alumane.
What is the SMILES notation for tris(pent-4-enyl)alumane?
The canonical SMILES for tris(pent-4-enyl)alumane is C=CCCC[Al](CCCC=C)CCCC=C.
What is the InChIKey of tris(pent-4-enyl)alumane?
The InChIKey is TZXFZYJPQYLXDS-UHFFFAOYSA-N. The full InChI is InChI=1S/3C5H9.Al/c3*1-3-5-4-2;/h3*3H,1-2,4-5H2;.
What are the key properties of tris(pent-4-enyl)alumane?
tris(pent-4-enyl)alumane has a molecular weight of 234.36 g/mol, XLogP of 5.38, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(pent-4-enyl)alumane is sourced from PubChem (CID 71365836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).