C4H2BrF7O — CID 71366137
2-bromo-1,1,1-trifluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane (PubChem CID 71366137) has the molecular formula C4H2BrF7O and a molecular weight of 278.95 g/mol. Its IUPAC name is 2-bromo-1,1,1-trifluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane.
| Compound Name | 2-bromo-1,1,1-trifluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane |
|---|---|
| PubChem CID | 71366137 |
| Molecular Formula | C4H2BrF7O |
| Molecular Weight | 278.95 g/mol |
| Exact Mass | 277.92 |
| IUPAC Name | 2-bromo-1,1,1-trifluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane |
| SMILES | FC(F)C(F)(F)OC(Br)C(F)(F)F |
| InChI | InChI=1S/C4H2BrF7O/c5-1(3(8,9)10)13-4(11,12)2(6)7/h1-2H |
| InChIKey | MPURDVJIOYWODR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.95 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|