C8H9F4NO2 — CID 71366180
4-propan-2-yl-2-(1,1,2,2-tetrafluoroethyl)-2H-1,3-oxazol-5-one (PubChem CID 71366180) has the molecular formula C8H9F4NO2 and a molecular weight of 227.16 g/mol. Its IUPAC name is 4-propan-2-yl-2-(1,1,2,2-tetrafluoroethyl)-2H-1,3-oxazol-5-one.
| Compound Name | 4-propan-2-yl-2-(1,1,2,2-tetrafluoroethyl)-2H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 71366180 |
| Molecular Formula | C8H9F4NO2 |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-propan-2-yl-2-(1,1,2,2-tetrafluoroethyl)-2H-1,3-oxazol-5-one |
| SMILES | CC(C)C1=NC(C(F)(F)C(F)F)OC1=O |
| InChI | InChI=1S/C8H9F4NO2/c1-3(2)4-5(14)15-7(13-4)8(11,12)6(9)10/h3,6-7H,1-2H3 |
| InChIKey | VOYBSYXQKRVJMJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|