C12H20O3 — CID 71366452
acetic acid;(1S,5R,6R)-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-ol (PubChem CID 71366452) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is acetic acid;(1S,5R,6R)-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-ol.
| Compound Name | acetic acid;(1S,5R,6R)-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-ol |
|---|---|
| PubChem CID | 71366452 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | acetic acid;(1S,5R,6R)-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-ol |
| SMILES | CC(=O)O.CC1=CC[C@H]2[C@@H](O)[C@@H]1C2(C)C |
| InChI | InChI=1S/C10H16O.C2H4O2/c1-6-4-5-7-9(11)8(6)10(7,2)3;1-2(3)4/h4,7-9,11H,5H2,1-3H3;1H3,(H,3,4)/t7-,8+,9+;/m0./s1 |
| InChIKey | VLHQXRFUXGPYFD-FZRXOQNUSA-N |
| XLogP | 2.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|