About (3S,4S)-3,4-dimethyldioxetane
(3S,4S)-3,4-dimethyldioxetane (PubChem CID 71366488) has the molecular formula C4H8O2
and a molecular weight of 88.11 g/mol. Its IUPAC name is (3S,4S)-3,4-dimethyldioxetane.
Molecular Properties
| Compound Name | (3S,4S)-3,4-dimethyldioxetane |
| PubChem CID | 71366488 |
| Molecular Formula | C4H8O2 |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.05 |
| IUPAC Name | (3S,4S)-3,4-dimethyldioxetane |
| SMILES | C[C@@H]1OO[C@H]1C |
| InChI | InChI=1S/C4H8O2/c1-3-4(2)6-5-3/h3-4H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | KHNQVTBXUYKGDF-IMJSIDKUSA-N |
| XLogP | 0.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3,4-dimethyldioxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-dimethyldioxetane?
The IUPAC name of (3S,4S)-3,4-dimethyldioxetane (CID 71366488) is (3S,4S)-3,4-dimethyldioxetane.
What is the SMILES notation for (3S,4S)-3,4-dimethyldioxetane?
The canonical SMILES for (3S,4S)-3,4-dimethyldioxetane is C[C@@H]1OO[C@H]1C.
What is the InChIKey of (3S,4S)-3,4-dimethyldioxetane?
The InChIKey is KHNQVTBXUYKGDF-IMJSIDKUSA-N. The full InChI is InChI=1S/C4H8O2/c1-3-4(2)6-5-3/h3-4H,1-2H3/t3-,4-/m0/s1.
What are the key properties of (3S,4S)-3,4-dimethyldioxetane?
(3S,4S)-3,4-dimethyldioxetane has a molecular weight of 88.11 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-dimethyldioxetane is sourced from PubChem (CID 71366488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).