About 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one
4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one (PubChem CID 71366675) has the molecular formula C52H55N3O4
and a molecular weight of 786.03 g/mol. Its IUPAC name is 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one |
| PubChem CID | 71366675 |
| Molecular Formula | C52H55N3O4 |
| Molecular Weight | 786.03 g/mol |
| Exact Mass | 785.42 |
| IUPAC Name | 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one |
| SMILES | CCCCCCCCn1c(-c2ccccc2)c(C2(c3c(-c4ccccc4)n(CCCCCCCC)c4ccccc34)OC(=O)c3cccc([N+](=O)[O-])c32)c2ccccc21 |
| InChI | InChI=1S/C52H55N3O4/c1-3-5-7-9-11-23-36-53-43-33-21-19-30-40(43)47(49(53)38-26-15-13-16-27-38)52(46-42(51(56)59-52)32-25-35-45(46)55(57)58)48-41-31-20-22-34-44(41)54(37-24-12-10-8-6-4-2)50(48)39-28-17-14-18-29-39/h13-22,25-35H,3-12,23-24,36-37H2,1-2H3 |
| InChIKey | SWOPYEHUBHCBKV-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 79.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 786.03 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one?
The IUPAC name of 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one (CID 71366675) is 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one.
What is the SMILES notation for 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one?
The canonical SMILES for 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one is CCCCCCCCn1c(-c2ccccc2)c(C2(c3c(-c4ccccc4)n(CCCCCCCC)c4ccccc34)OC(=O)c3cccc([N+](=O)[O-])c32)c2ccccc21.
What is the InChIKey of 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one?
The InChIKey is SWOPYEHUBHCBKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H55N3O4/c1-3-5-7-9-11-23-36-53-43-33-21-19-30-40(43)47(49(53)38-26-15-13-16-27-38)52(46-42(51(56)59-52)32-25-35-45(46)55(57)58)48-41-31-20-22-34-44(41)54(37-24-12-10-8-6-4-2)50(48)39-28-17-14-18-29-39/h13-22,25-35H,3-12,23-24,36-37H2,1-2H3.
What are the key properties of 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one?
4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one has a molecular weight of 786.03 g/mol, XLogP of 14.02, 19 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-3,3-bis(1-octyl-2-phenylindol-3-yl)-2-benzofuran-1-one is sourced from PubChem (CID 71366675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).