C28H29ClFNO2 — CID 71366999
4-[4-[(4-chlorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]-4-fluoro-1-phenylbutan-1-one (PubChem CID 71366999) has the molecular formula C28H29ClFNO2 and a molecular weight of 466.00 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]-4-fluoro-1-phenylbutan-1-one.
| Compound Name | 4-[4-[(4-chlorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]-4-fluoro-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 71366999 |
| Molecular Formula | C28H29ClFNO2 |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)-hydroxy-phenylmethyl]piperidin-1-yl]-4-fluoro-1-phenylbutan-1-one |
| SMILES | O=C(CCC(F)N1CCC(C(O)(c2ccccc2)c2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H29ClFNO2/c29-25-13-11-23(12-14-25)28(33,22-9-5-2-6-10-22)24-17-19-31(20-18-24)27(30)16-15-26(32)21-7-3-1-4-8-21/h1-14,24,27,33H,15-20H2 |
| InChIKey | WQZQMOPFOSDIRR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|