dichlorophosphinoselenous acid

HCl2PSe — CID 71367108

IUPACdichlorophosphinoselenous acid
SMILESClP(Cl)[SeH]
InChIInChI=1S/Cl2HPSe/c1-3(2)4/h4H
InChIKeyLRAIMBDPPPUOPP-UHFFFAOYSA-N
MW181.85 g/mol
LogP1.59
Rot. Bonds

About dichlorophosphinoselenous acid

dichlorophosphinoselenous acid (PubChem CID 71367108) has the molecular formula HCl2PSe and a molecular weight of 181.85 g/mol. Its IUPAC name is dichlorophosphinoselenous acid.

Molecular Properties

Compound Namedichlorophosphinoselenous acid
PubChem CID71367108
Molecular FormulaHCl2PSe
Molecular Weight181.85 g/mol
Exact Mass181.84
IUPAC Namedichlorophosphinoselenous acid
SMILESClP(Cl)[SeH]
InChIInChI=1S/Cl2HPSe/c1-3(2)4/h4H
InChIKeyLRAIMBDPPPUOPP-UHFFFAOYSA-N
XLogP1.59
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms4
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.85
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dichlorophosphinoselenous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dichlorophosphinoselenous acid?
The IUPAC name of dichlorophosphinoselenous acid (CID 71367108) is dichlorophosphinoselenous acid.
What is the SMILES notation for dichlorophosphinoselenous acid?
The canonical SMILES for dichlorophosphinoselenous acid is ClP(Cl)[SeH].
What is the InChIKey of dichlorophosphinoselenous acid?
The InChIKey is LRAIMBDPPPUOPP-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2HPSe/c1-3(2)4/h4H.
What are the key properties of dichlorophosphinoselenous acid?
dichlorophosphinoselenous acid has a molecular weight of 181.85 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorophosphinoselenous acid is sourced from PubChem (CID 71367108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).