About 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid
2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid (PubChem CID 71367221) has the molecular formula C10H18O6
and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid |
| PubChem CID | 71367221 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid |
| SMILES | CC(C)(OCC(=O)O)C(C)(C)OCC(=O)O |
| InChI | InChI=1S/C10H18O6/c1-9(2,15-5-7(11)12)10(3,4)16-6-8(13)14/h5-6H2,1-4H3,(H,11,12)(H,13,14) |
| InChIKey | BBLBSJIXWZBFQY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid?
The IUPAC name of 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid (CID 71367221) is 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid.
What is the SMILES notation for 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid?
The canonical SMILES for 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid is CC(C)(OCC(=O)O)C(C)(C)OCC(=O)O.
What is the InChIKey of 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid?
The InChIKey is BBLBSJIXWZBFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O6/c1-9(2,15-5-7(11)12)10(3,4)16-6-8(13)14/h5-6H2,1-4H3,(H,11,12)(H,13,14).
What are the key properties of 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid?
2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid has a molecular weight of 234.25 g/mol, XLogP of 0.75, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(carboxymethoxy)-2,3-dimethylbutan-2-yl]oxyacetic acid is sourced from PubChem (CID 71367221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).