C20H37N — CID 71367480
2,2,6,6-tetramethyl-4-undec-10-enylidenepiperidine (PubChem CID 71367480) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-undec-10-enylidenepiperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-undec-10-enylidenepiperidine |
|---|---|
| PubChem CID | 71367480 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-undec-10-enylidenepiperidine |
| SMILES | C=CCCCCCCCCC=C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H37N/c1-6-7-8-9-10-11-12-13-14-15-18-16-19(2,3)21-20(4,5)17-18/h6,15,21H,1,7-14,16-17H2,2-5H3 |
| InChIKey | WLVIQZKJRLSQCS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|