C16H26O2 — CID 71367518
6,6-bis(methoxymethyl)-2,4-dimethyldeca-2,3-dien-8-yne (PubChem CID 71367518) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 6,6-bis(methoxymethyl)-2,4-dimethyldeca-2,3-dien-8-yne.
| Compound Name | 6,6-bis(methoxymethyl)-2,4-dimethyldeca-2,3-dien-8-yne |
|---|---|
| PubChem CID | 71367518 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 6,6-bis(methoxymethyl)-2,4-dimethyldeca-2,3-dien-8-yne |
| SMILES | CC#CCC(COC)(COC)CC(C)=C=C(C)C |
| InChI | InChI=1S/C16H26O2/c1-7-8-9-16(12-17-5,13-18-6)11-15(4)10-14(2)3/h9,11-13H2,1-6H3 |
| InChIKey | NNGSEMIPLXDOLE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|